C31H21BrClN3O6S — CID 3394364
2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-[4-chloro-2-(3,4,5-trimethoxybenzoyl)anilino]prop-2-enenitrile (PubChem CID 3394364) has the molecular formula C31H21BrClN3O6S and a molecular weight of 678.95 g/mol. Its IUPAC name is 2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-[4-chloro-2-(3,4,5-trimethoxybenzoyl)anilino]prop-2-enenitrile.
| Compound Name | 2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-[4-chloro-2-(3,4,5-trimethoxybenzoyl)anilino]prop-2-enenitrile |
|---|---|
| PubChem CID | 3394364 |
| Molecular Formula | C31H21BrClN3O6S |
| Molecular Weight | 678.95 g/mol |
| Exact Mass | 677.00 |
| IUPAC Name | 2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-[4-chloro-2-(3,4,5-trimethoxybenzoyl)anilino]prop-2-enenitrile |
| SMILES | COc1cc(C(=O)c2cc(Cl)ccc2NC=C(C#N)c2nc(-c3cc4cc(Br)ccc4oc3=O)cs2)cc(OC)c1OC |
| InChI | InChI=1S/C31H21BrClN3O6S/c1-39-26-10-17(11-27(40-2)29(26)41-3)28(37)21-12-20(33)5-6-23(21)35-14-18(13-34)30-36-24(15-43-30)22-9-16-8-19(32)4-7-25(16)42-31(22)38/h4-12,14-15,35H,1-3H3 |
| InChIKey | NWOCRXAWIPUCFD-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.95 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|