C23H15BrN4O3S — CID 1417376
N-[4-[[(E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]phenyl]acetamide (PubChem CID 1417376) has the molecular formula C23H15BrN4O3S and a molecular weight of 507.37 g/mol. Its IUPAC name is N-[4-[[(E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[(E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 1417376 |
| Molecular Formula | C23H15BrN4O3S |
| Molecular Weight | 507.37 g/mol |
| Exact Mass | 506.00 |
| IUPAC Name | N-[4-[[(E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N/C=C(\C#N)c2nc(-c3cc4cc(Br)ccc4oc3=O)cs2)cc1 |
| InChI | InChI=1S/C23H15BrN4O3S/c1-13(29)27-18-5-3-17(4-6-18)26-11-15(10-25)22-28-20(12-32-22)19-9-14-8-16(24)2-7-21(14)31-23(19)30/h2-9,11-12,26H,1H3,(H,27,29)/b15-11+ |
| InChIKey | WPDZVLFDAUNWGG-RVDMUPIBSA-N |
| XLogP | 5.61 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.37 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|