C20H11BrN2O3S — CID 5345032
(E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(5-methylfuran-2-yl)prop-2-enenitrile (PubChem CID 5345032) has the molecular formula C20H11BrN2O3S and a molecular weight of 439.29 g/mol. Its IUPAC name is (E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(5-methylfuran-2-yl)prop-2-enenitrile.
| Compound Name | (E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(5-methylfuran-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 5345032 |
| Molecular Formula | C20H11BrN2O3S |
| Molecular Weight | 439.29 g/mol |
| Exact Mass | 437.97 |
| IUPAC Name | (E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(5-methylfuran-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccc(/C=C(\C#N)c2nc(-c3cc4cc(Br)ccc4oc3=O)cs2)o1 |
| InChI | InChI=1S/C20H11BrN2O3S/c1-11-2-4-15(25-11)7-13(9-22)19-23-17(10-27-19)16-8-12-6-14(21)3-5-18(12)26-20(16)24/h2-8,10H,1H3/b13-7+ |
| InChIKey | XLBCMEOWQUUDSN-NTUHNPAUSA-N |
| XLogP | 5.64 |
| TPSA | 80.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.29 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|