C25H11Cl3N2O3S — CID 6196944
(E)-2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-[5-(3,4-dichlorophenyl)furan-2-yl]prop-2-enenitrile (PubChem CID 6196944) has the molecular formula C25H11Cl3N2O3S and a molecular weight of 525.80 g/mol. Its IUPAC name is (E)-2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-[5-(3,4-dichlorophenyl)furan-2-yl]prop-2-enenitrile.
| Compound Name | (E)-2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-[5-(3,4-dichlorophenyl)furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6196944 |
| Molecular Formula | C25H11Cl3N2O3S |
| Molecular Weight | 525.80 g/mol |
| Exact Mass | 523.96 |
| IUPAC Name | (E)-2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-[5-(3,4-dichlorophenyl)furan-2-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(Cl)c(Cl)c2)o1)c1nc(-c2cc3cc(Cl)ccc3oc2=O)cs1 |
| InChI | InChI=1S/C25H11Cl3N2O3S/c26-16-2-5-23-14(7-16)9-18(25(31)33-23)21-12-34-24(30-21)15(11-29)8-17-3-6-22(32-17)13-1-4-19(27)20(28)10-13/h1-10,12H/b15-8+ |
| InChIKey | MTWTTYQMAMQCBM-OVCLIPMQSA-N |
| XLogP | 8.20 |
| TPSA | 80.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.80 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|