C25H12ClN3O5S — CID 4710224
2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enenitrile (PubChem CID 4710224) has the molecular formula C25H12ClN3O5S and a molecular weight of 501.91 g/mol. Its IUPAC name is 2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enenitrile.
| Compound Name | 2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4710224 |
| Molecular Formula | C25H12ClN3O5S |
| Molecular Weight | 501.91 g/mol |
| Exact Mass | 501.02 |
| IUPAC Name | 2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(-c2ccc([N+](=O)[O-])cc2)o1)c1nc(-c2cc3cc(Cl)ccc3oc2=O)cs1 |
| InChI | InChI=1S/C25H12ClN3O5S/c26-17-3-7-23-15(9-17)11-20(25(30)34-23)21-13-35-24(28-21)16(12-27)10-19-6-8-22(33-19)14-1-4-18(5-2-14)29(31)32/h1-11,13H |
| InChIKey | WHTMGTNKHRHXCO-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 123.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.91 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|