C22H13N3O4S — CID 3402195
3-(4-methylphenyl)-2-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 3402195) has the molecular formula C22H13N3O4S and a molecular weight of 415.43 g/mol. Its IUPAC name is 3-(4-methylphenyl)-2-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-(4-methylphenyl)-2-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3402195 |
| Molecular Formula | C22H13N3O4S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 3-(4-methylphenyl)-2-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | Cc1ccc(C=C(C#N)c2nc(-c3cc4cc([N+](=O)[O-])ccc4oc3=O)cs2)cc1 |
| InChI | InChI=1S/C22H13N3O4S/c1-13-2-4-14(5-3-13)8-16(11-23)21-24-19(12-30-21)18-10-15-9-17(25(27)28)6-7-20(15)29-22(18)26/h2-10,12H,1H3 |
| InChIKey | AJYNSZRRWPGPRC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 110.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|