C25H12Cl2N2O3S — CID 2960171
3-[5-(2,6-dichlorophenyl)furan-2-yl]-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 2960171) has the molecular formula C25H12Cl2N2O3S and a molecular weight of 491.36 g/mol. Its IUPAC name is 3-[5-(2,6-dichlorophenyl)furan-2-yl]-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-[5-(2,6-dichlorophenyl)furan-2-yl]-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 2960171 |
| Molecular Formula | C25H12Cl2N2O3S |
| Molecular Weight | 491.36 g/mol |
| Exact Mass | 489.99 |
| IUPAC Name | 3-[5-(2,6-dichlorophenyl)furan-2-yl]-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(-c2c(Cl)cccc2Cl)o1)c1nc(-c2cc3ccccc3oc2=O)cs1 |
| InChI | InChI=1S/C25H12Cl2N2O3S/c26-18-5-3-6-19(27)23(18)22-9-8-16(31-22)10-15(12-28)24-29-20(13-33-24)17-11-14-4-1-2-7-21(14)32-25(17)30/h1-11,13H |
| InChIKey | VZWBCVLGJHTMDD-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 80.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.36 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|