C21H12N2O3S — CID 6052712
(E)-3-(3-hydroxyphenyl)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 6052712) has the molecular formula C21H12N2O3S and a molecular weight of 372.41 g/mol. Its IUPAC name is (E)-3-(3-hydroxyphenyl)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-(3-hydroxyphenyl)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6052712 |
| Molecular Formula | C21H12N2O3S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | (E)-3-(3-hydroxyphenyl)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cccc(O)c1)c1nc(-c2cc3ccccc3oc2=O)cs1 |
| InChI | InChI=1S/C21H12N2O3S/c22-11-15(8-13-4-3-6-16(24)9-13)20-23-18(12-27-20)17-10-14-5-1-2-7-19(14)26-21(17)25/h1-10,12,24H/b15-8+ |
| InChIKey | CHVFQAJEVWCVQU-OVCLIPMQSA-N |
| XLogP | 4.69 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|