C25H18N2O6S — CID 4638130
[4-[2-cyano-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]ethenyl]-2,6-dimethoxyphenyl] acetate (PubChem CID 4638130) has the molecular formula C25H18N2O6S and a molecular weight of 474.49 g/mol. Its IUPAC name is [4-[2-cyano-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]ethenyl]-2,6-dimethoxyphenyl] acetate.
| Compound Name | [4-[2-cyano-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]ethenyl]-2,6-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 4638130 |
| Molecular Formula | C25H18N2O6S |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | [4-[2-cyano-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]ethenyl]-2,6-dimethoxyphenyl] acetate |
| SMILES | COc1cc(C=C(C#N)c2nc(-c3cc4ccccc4oc3=O)cs2)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C25H18N2O6S/c1-14(28)32-23-21(30-2)9-15(10-22(23)31-3)8-17(12-26)24-27-19(13-34-24)18-11-16-6-4-5-7-20(16)33-25(18)29/h4-11,13H,1-3H3 |
| InChIKey | SNALALZYHJYQMB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 111.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|