C22H15N3O3S — CID 5144333
3-(2-methoxyanilino)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 5144333) has the molecular formula C22H15N3O3S and a molecular weight of 401.45 g/mol. Its IUPAC name is 3-(2-methoxyanilino)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-(2-methoxyanilino)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 5144333 |
| Molecular Formula | C22H15N3O3S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 3-(2-methoxyanilino)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | COc1ccccc1NC=C(C#N)c1nc(-c2cc3ccccc3oc2=O)cs1 |
| InChI | InChI=1S/C22H15N3O3S/c1-27-20-9-5-3-7-17(20)24-12-15(11-23)21-25-18(13-29-21)16-10-14-6-2-4-8-19(14)28-22(16)26/h2-10,12-13,24H,1H3 |
| InChIKey | VCUCPYHYJRCGRV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|