C22H13BrClN3O3S — CID 4565109
2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(5-chloro-2-methoxyanilino)prop-2-enenitrile (PubChem CID 4565109) has the molecular formula C22H13BrClN3O3S and a molecular weight of 514.79 g/mol. Its IUPAC name is 2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(5-chloro-2-methoxyanilino)prop-2-enenitrile.
| Compound Name | 2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(5-chloro-2-methoxyanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 4565109 |
| Molecular Formula | C22H13BrClN3O3S |
| Molecular Weight | 514.79 g/mol |
| Exact Mass | 512.95 |
| IUPAC Name | 2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(5-chloro-2-methoxyanilino)prop-2-enenitrile |
| SMILES | COc1ccc(Cl)cc1NC=C(C#N)c1nc(-c2cc3cc(Br)ccc3oc2=O)cs1 |
| InChI | InChI=1S/C22H13BrClN3O3S/c1-29-20-5-3-15(24)8-17(20)26-10-13(9-25)21-27-18(11-31-21)16-7-12-6-14(23)2-4-19(12)30-22(16)28/h2-8,10-11,26H,1H3 |
| InChIKey | XCUNUAUAIJZJOU-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.79 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|