C21H9BrCl2N2O2S — CID 56687600
(Z)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(2,4-dichlorophenyl)prop-2-enenitrile (PubChem CID 56687600) has the molecular formula C21H9BrCl2N2O2S and a molecular weight of 504.19 g/mol. Its IUPAC name is (Z)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(2,4-dichlorophenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(2,4-dichlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 56687600 |
| Molecular Formula | C21H9BrCl2N2O2S |
| Molecular Weight | 504.19 g/mol |
| Exact Mass | 501.89 |
| IUPAC Name | (Z)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(2,4-dichlorophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1ccc(Cl)cc1Cl)c1nc(-c2cc3cc(Br)ccc3oc2=O)cs1 |
| InChI | InChI=1S/C21H9BrCl2N2O2S/c22-14-2-4-19-12(6-14)7-16(21(27)28-19)18-10-29-20(26-18)13(9-25)5-11-1-3-15(23)8-17(11)24/h1-8,10H/b13-5- |
| InChIKey | XFURHNRTLSMCCC-ACAGNQJTSA-N |
| XLogP | 7.05 |
| TPSA | 66.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.19 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|