C28H14ClN3O3S — CID 4710336
2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enenitrile (PubChem CID 4710336) has the molecular formula C28H14ClN3O3S and a molecular weight of 507.96 g/mol. Its IUPAC name is 2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enenitrile.
| Compound Name | 2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4710336 |
| Molecular Formula | C28H14ClN3O3S |
| Molecular Weight | 507.96 g/mol |
| Exact Mass | 507.04 |
| IUPAC Name | 2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc2noc(-c3ccccc3)c2c1)c1nc(-c2cc3cc(Cl)ccc3oc2=O)cs1 |
| InChI | InChI=1S/C28H14ClN3O3S/c29-20-7-9-25-18(12-20)13-22(28(33)34-25)24-15-36-27(31-24)19(14-30)10-16-6-8-23-21(11-16)26(35-32-23)17-4-2-1-3-5-17/h1-13,15H |
| InChIKey | IUCBEVCZXQPRDU-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 92.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.96 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|