C23H13N3O2S — CID 92932690
(Z)-2-[4-(furan-2-yl)-1,3-thiazol-2-yl]-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enenitrile (PubChem CID 92932690) has the molecular formula C23H13N3O2S and a molecular weight of 395.44 g/mol. Its IUPAC name is (Z)-2-[4-(furan-2-yl)-1,3-thiazol-2-yl]-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(furan-2-yl)-1,3-thiazol-2-yl]-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 92932690 |
| Molecular Formula | C23H13N3O2S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | (Z)-2-[4-(furan-2-yl)-1,3-thiazol-2-yl]-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1ccc2noc(-c3ccccc3)c2c1)c1nc(-c2ccco2)cs1 |
| InChI | InChI=1S/C23H13N3O2S/c24-13-17(23-25-20(14-29-23)21-7-4-10-27-21)11-15-8-9-19-18(12-15)22(28-26-19)16-5-2-1-3-6-16/h1-12,14H/b17-11- |
| InChIKey | LFWPSMBRUNEOJU-BOPFTXTBSA-N |
| XLogP | 6.28 |
| TPSA | 75.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|