C18H12N2S — CID 2837945
3-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 2837945) has the molecular formula C18H12N2S and a molecular weight of 288.38 g/mol. Its IUPAC name is 3-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2837945 |
| Molecular Formula | C18H12N2S |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 3-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccccc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H12N2S/c19-12-16(11-14-7-3-1-4-8-14)18-20-17(13-21-18)15-9-5-2-6-10-15/h1-11,13H |
| InChIKey | HASYGYFEXQRRMK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|