C20H16N2S — CID 52643567
(E)-3-(3,4-dimethylphenyl)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 52643567) has the molecular formula C20H16N2S and a molecular weight of 316.43 g/mol. Its IUPAC name is (E)-3-(3,4-dimethylphenyl)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(3,4-dimethylphenyl)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 52643567 |
| Molecular Formula | C20H16N2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (E)-3-(3,4-dimethylphenyl)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccc(/C=C(\C#N)c2nc(-c3ccccc3)cs2)cc1C |
| InChI | InChI=1S/C20H16N2S/c1-14-8-9-16(10-15(14)2)11-18(12-21)20-22-19(13-23-20)17-6-4-3-5-7-17/h3-11,13H,1-2H3/b18-11+ |
| InChIKey | OPQGVEXDQOLXGX-WOJGMQOQSA-N |
| XLogP | 5.49 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|