C25H18N2S — CID 7121264
(Z)-3-(2-methylphenyl)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 7121264) has the molecular formula C25H18N2S and a molecular weight of 378.50 g/mol. Its IUPAC name is (Z)-3-(2-methylphenyl)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (Z)-3-(2-methylphenyl)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 7121264 |
| Molecular Formula | C25H18N2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (Z)-3-(2-methylphenyl)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | Cc1ccccc1/C=C(/C#N)c1nc(-c2ccc(-c3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C25H18N2S/c1-18-7-5-6-10-22(18)15-23(16-26)25-27-24(17-28-25)21-13-11-20(12-14-21)19-8-3-2-4-9-19/h2-15,17H,1H3/b23-15- |
| InChIKey | UFRSYJPAKPHMCZ-HAHDFKILSA-N |
| XLogP | 6.85 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|