C25H19N3S — CID 6091876
(E)-3-(2-methylanilino)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 6091876) has the molecular formula C25H19N3S and a molecular weight of 393.52 g/mol. Its IUPAC name is (E)-3-(2-methylanilino)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-(2-methylanilino)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6091876 |
| Molecular Formula | C25H19N3S |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | (E)-3-(2-methylanilino)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | Cc1ccccc1N/C=C(\C#N)c1nc(-c2ccc(-c3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C25H19N3S/c1-18-7-5-6-10-23(18)27-16-22(15-26)25-28-24(17-29-25)21-13-11-20(12-14-21)19-8-3-2-4-9-19/h2-14,16-17,27H,1H3/b22-16+ |
| InChIKey | JWEIQPLOXISLKT-CJLVFECKSA-N |
| XLogP | 6.76 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|