C28H25N3S — CID 23964128
3-(4-butylanilino)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 23964128) has the molecular formula C28H25N3S and a molecular weight of 435.60 g/mol. Its IUPAC name is 3-(4-butylanilino)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-(4-butylanilino)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 23964128 |
| Molecular Formula | C28H25N3S |
| Molecular Weight | 435.60 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 3-(4-butylanilino)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | CCCCc1ccc(NC=C(C#N)c2nc(-c3ccc(-c4ccccc4)cc3)cs2)cc1 |
| InChI | InChI=1S/C28H25N3S/c1-2-3-7-21-10-16-26(17-11-21)30-19-25(18-29)28-31-27(20-32-28)24-14-12-23(13-15-24)22-8-5-4-6-9-22/h4-6,8-17,19-20,30H,2-3,7H2,1H3 |
| InChIKey | QTZWRCNJWIJSMJ-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.60 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|