C24H25N3S — CID 23761158
3-(4-butylanilino)-2-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 23761158) has the molecular formula C24H25N3S and a molecular weight of 387.55 g/mol. Its IUPAC name is 3-(4-butylanilino)-2-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-(4-butylanilino)-2-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 23761158 |
| Molecular Formula | C24H25N3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 3-(4-butylanilino)-2-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | CCCCc1ccc(NC=C(C#N)c2nc(-c3ccc(CC)cc3)cs2)cc1 |
| InChI | InChI=1S/C24H25N3S/c1-3-5-6-19-9-13-22(14-10-19)26-16-21(15-25)24-27-23(17-28-24)20-11-7-18(4-2)8-12-20/h7-14,16-17,26H,3-6H2,1-2H3 |
| InChIKey | QTEQKIISFOCVJH-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|