C20H15Cl2N3S — CID 3832535
2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(4-ethylanilino)prop-2-enenitrile (PubChem CID 3832535) has the molecular formula C20H15Cl2N3S and a molecular weight of 400.33 g/mol. Its IUPAC name is 2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(4-ethylanilino)prop-2-enenitrile.
| Compound Name | 2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(4-ethylanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 3832535 |
| Molecular Formula | C20H15Cl2N3S |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(4-ethylanilino)prop-2-enenitrile |
| SMILES | CCc1ccc(NC=C(C#N)c2nc(-c3ccc(Cl)c(Cl)c3)cs2)cc1 |
| InChI | InChI=1S/C20H15Cl2N3S/c1-2-13-3-6-16(7-4-13)24-11-15(10-23)20-25-19(12-26-20)14-5-8-17(21)18(22)9-14/h3-9,11-12,24H,2H2,1H3 |
| InChIKey | OGORAZUYOFPJAN-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|