C19H10Cl2F3N3S — CID 3642538
2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-[3-(trifluoromethyl)anilino]prop-2-enenitrile (PubChem CID 3642538) has the molecular formula C19H10Cl2F3N3S and a molecular weight of 440.28 g/mol. Its IUPAC name is 2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-[3-(trifluoromethyl)anilino]prop-2-enenitrile.
| Compound Name | 2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-[3-(trifluoromethyl)anilino]prop-2-enenitrile |
|---|---|
| PubChem CID | 3642538 |
| Molecular Formula | C19H10Cl2F3N3S |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 438.99 |
| IUPAC Name | 2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-[3-(trifluoromethyl)anilino]prop-2-enenitrile |
| SMILES | N#CC(=CNc1cccc(C(F)(F)F)c1)c1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C19H10Cl2F3N3S/c20-15-5-4-11(6-16(15)21)17-10-28-18(27-17)12(8-25)9-26-14-3-1-2-13(7-14)19(22,23)24/h1-7,9-10,26H |
| InChIKey | ZHUOEJLZZDGZBE-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|