C21H12Cl2N4S — CID 6080150
(E)-2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(quinolin-6-ylamino)prop-2-enenitrile (PubChem CID 6080150) has the molecular formula C21H12Cl2N4S and a molecular weight of 423.33 g/mol. Its IUPAC name is (E)-2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(quinolin-6-ylamino)prop-2-enenitrile.
| Compound Name | (E)-2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(quinolin-6-ylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 6080150 |
| Molecular Formula | C21H12Cl2N4S |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | (E)-2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(quinolin-6-ylamino)prop-2-enenitrile |
| SMILES | N#C/C(=C\Nc1ccc2ncccc2c1)c1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C21H12Cl2N4S/c22-17-5-3-14(9-18(17)23)20-12-28-21(27-20)15(10-24)11-26-16-4-6-19-13(8-16)2-1-7-25-19/h1-9,11-12,26H/b15-11+ |
| InChIKey | AJSMUWXZRYSWPX-RVDMUPIBSA-N |
| XLogP | 6.64 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|