C21H14N4S — CID 1389538
2-(4-phenyl-1,3-thiazol-2-yl)-3-(quinolin-6-ylamino)prop-2-enenitrile (PubChem CID 1389538) has the molecular formula C21H14N4S and a molecular weight of 354.44 g/mol. Its IUPAC name is 2-(4-phenyl-1,3-thiazol-2-yl)-3-(quinolin-6-ylamino)prop-2-enenitrile.
| Compound Name | 2-(4-phenyl-1,3-thiazol-2-yl)-3-(quinolin-6-ylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 1389538 |
| Molecular Formula | C21H14N4S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 2-(4-phenyl-1,3-thiazol-2-yl)-3-(quinolin-6-ylamino)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc2ncccc2c1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C21H14N4S/c22-12-17(21-25-20(14-26-21)15-5-2-1-3-6-15)13-24-18-8-9-19-16(11-18)7-4-10-23-19/h1-11,13-14,24H |
| InChIKey | OGSPXWVEAUCNRS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|