C18H12BrN3S — CID 1223314
(E)-3-anilino-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 1223314) has the molecular formula C18H12BrN3S and a molecular weight of 382.29 g/mol. Its IUPAC name is (E)-3-anilino-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-anilino-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 1223314 |
| Molecular Formula | C18H12BrN3S |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | (E)-3-anilino-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C\Nc1ccccc1)c1nc(-c2cccc(Br)c2)cs1 |
| InChI | InChI=1S/C18H12BrN3S/c19-15-6-4-5-13(9-15)17-12-23-18(22-17)14(10-20)11-21-16-7-2-1-3-8-16/h1-9,11-12,21H/b14-11+ |
| InChIKey | PYOBRCXEGKIWGN-SDNWHVSQSA-N |
| XLogP | 5.55 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|