C19H10BrClF3N3S — CID 51045223
(Z)-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-[4-chloro-3-(trifluoromethyl)anilino]prop-2-enenitrile (PubChem CID 51045223) has the molecular formula C19H10BrClF3N3S and a molecular weight of 484.73 g/mol. Its IUPAC name is (Z)-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-[4-chloro-3-(trifluoromethyl)anilino]prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-[4-chloro-3-(trifluoromethyl)anilino]prop-2-enenitrile |
|---|---|
| PubChem CID | 51045223 |
| Molecular Formula | C19H10BrClF3N3S |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 482.94 |
| IUPAC Name | (Z)-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-[4-chloro-3-(trifluoromethyl)anilino]prop-2-enenitrile |
| SMILES | N#C/C(=C/Nc1ccc(Cl)c(C(F)(F)F)c1)c1nc(-c2cccc(Br)c2)cs1 |
| InChI | InChI=1S/C19H10BrClF3N3S/c20-13-3-1-2-11(6-13)17-10-28-18(27-17)12(8-25)9-26-14-4-5-16(21)15(7-14)19(22,23)24/h1-7,9-10,26H/b12-9- |
| InChIKey | DWIMSAHLAGEYBK-XFXZXTDPSA-N |
| XLogP | 7.22 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|