C18H10BrClN2S — CID 3118456
2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(2-chlorophenyl)prop-2-enenitrile (PubChem CID 3118456) has the molecular formula C18H10BrClN2S and a molecular weight of 401.72 g/mol. Its IUPAC name is 2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(2-chlorophenyl)prop-2-enenitrile.
| Compound Name | 2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(2-chlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3118456 |
| Molecular Formula | C18H10BrClN2S |
| Molecular Weight | 401.72 g/mol |
| Exact Mass | 399.94 |
| IUPAC Name | 2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(2-chlorophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccccc1Cl)c1nc(-c2cccc(Br)c2)cs1 |
| InChI | InChI=1S/C18H10BrClN2S/c19-15-6-3-5-13(9-15)17-11-23-18(22-17)14(10-21)8-12-4-1-2-7-16(12)20/h1-9,11H |
| InChIKey | POMBWKWKFRMQSQ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.72 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|