C22H13BrN2S — CID 5338042
(E)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-naphthalen-1-ylprop-2-enenitrile (PubChem CID 5338042) has the molecular formula C22H13BrN2S and a molecular weight of 417.33 g/mol. Its IUPAC name is (E)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-naphthalen-1-ylprop-2-enenitrile.
| Compound Name | (E)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-naphthalen-1-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 5338042 |
| Molecular Formula | C22H13BrN2S |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | (E)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-naphthalen-1-ylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1cccc2ccccc12)c1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C22H13BrN2S/c23-19-10-8-16(9-11-19)21-14-26-22(25-21)18(13-24)12-17-6-3-5-15-4-1-2-7-20(15)17/h1-12,14H/b18-12+ |
| InChIKey | KIVAAIRJOZDWMF-LDADJPATSA-N |
| XLogP | 6.79 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|