C24H13BrN2S2 — CID 6009555
(E)-3-(4-bromophenyl)-2-(4-dibenzothiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 6009555) has the molecular formula C24H13BrN2S2 and a molecular weight of 473.42 g/mol. Its IUPAC name is (E)-3-(4-bromophenyl)-2-(4-dibenzothiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(4-bromophenyl)-2-(4-dibenzothiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6009555 |
| Molecular Formula | C24H13BrN2S2 |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 471.97 |
| IUPAC Name | (E)-3-(4-bromophenyl)-2-(4-dibenzothiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(Br)cc1)c1nc(-c2ccc3sc4ccccc4c3c2)cs1 |
| InChI | InChI=1S/C24H13BrN2S2/c25-18-8-5-15(6-9-18)11-17(13-26)24-27-21(14-28-24)16-7-10-23-20(12-16)19-3-1-2-4-22(19)29-23/h1-12,14H/b17-11+ |
| InChIKey | QJPONZVZUWQEMQ-GZTJUZNOSA-N |
| XLogP | 8.00 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|