C26H22N2S — CID 18864215
(E)-3-(4-tert-butylphenyl)-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 18864215) has the molecular formula C26H22N2S and a molecular weight of 394.54 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(4-tert-butylphenyl)-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 18864215 |
| Molecular Formula | C26H22N2S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | CC(C)(C)c1ccc(/C=C(\C#N)c2nc(-c3ccc4ccccc4c3)cs2)cc1 |
| InChI | InChI=1S/C26H22N2S/c1-26(2,3)23-12-8-18(9-13-23)14-22(16-27)25-28-24(17-29-25)21-11-10-19-6-4-5-7-20(19)15-21/h4-15,17H,1-3H3/b22-14+ |
| InChIKey | LKDKXPFJMXFEIB-HYARGMPZSA-N |
| XLogP | 7.32 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|