C26H16N2OS — CID 18864012
(E)-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-3-(5-phenylfuran-2-yl)prop-2-enenitrile (PubChem CID 18864012) has the molecular formula C26H16N2OS and a molecular weight of 404.49 g/mol. Its IUPAC name is (E)-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-3-(5-phenylfuran-2-yl)prop-2-enenitrile.
| Compound Name | (E)-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-3-(5-phenylfuran-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 18864012 |
| Molecular Formula | C26H16N2OS |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (E)-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-3-(5-phenylfuran-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2ccccc2)o1)c1nc(-c2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C26H16N2OS/c27-16-22(15-23-12-13-25(29-23)19-7-2-1-3-8-19)26-28-24(17-30-26)21-11-10-18-6-4-5-9-20(18)14-21/h1-15,17H/b22-15+ |
| InChIKey | LXTQFKPODJIQCX-PXLXIMEGSA-N |
| XLogP | 7.29 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|