C23H14F2N2OS2 — CID 6295337
(E)-3-[5-[4-(difluoromethylsulfanyl)phenyl]furan-2-yl]-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 6295337) has the molecular formula C23H14F2N2OS2 and a molecular weight of 436.51 g/mol. Its IUPAC name is (E)-3-[5-[4-(difluoromethylsulfanyl)phenyl]furan-2-yl]-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[5-[4-(difluoromethylsulfanyl)phenyl]furan-2-yl]-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6295337 |
| Molecular Formula | C23H14F2N2OS2 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | (E)-3-[5-[4-(difluoromethylsulfanyl)phenyl]furan-2-yl]-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(SC(F)F)cc2)o1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C23H14F2N2OS2/c24-23(25)30-19-9-6-16(7-10-19)21-11-8-18(28-21)12-17(13-26)22-27-20(14-29-22)15-4-2-1-3-5-15/h1-12,14,23H/b17-12+ |
| InChIKey | GQZPTGWWIRAAND-SFQUDFHCSA-N |
| XLogP | 7.45 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|