C23H12ClN3OS2 — CID 4685882
3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 4685882) has the molecular formula C23H12ClN3OS2 and a molecular weight of 445.96 g/mol. Its IUPAC name is 3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4685882 |
| Molecular Formula | C23H12ClN3OS2 |
| Molecular Weight | 445.96 g/mol |
| Exact Mass | 445.01 |
| IUPAC Name | 3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(-c2nc3ccccc3s2)o1)c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C23H12ClN3OS2/c24-16-7-5-14(6-8-16)19-13-29-22(27-19)15(12-25)11-17-9-10-20(28-17)23-26-18-3-1-2-4-21(18)30-23/h1-11,13H |
| InChIKey | SPLCSUDARKUIAR-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.96 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|