C26H15ClN2OS — CID 18864013
(E)-3-[5-(4-chlorophenyl)furan-2-yl]-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 18864013) has the molecular formula C26H15ClN2OS and a molecular weight of 438.94 g/mol. Its IUPAC name is (E)-3-[5-(4-chlorophenyl)furan-2-yl]-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[5-(4-chlorophenyl)furan-2-yl]-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 18864013 |
| Molecular Formula | C26H15ClN2OS |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | (E)-3-[5-(4-chlorophenyl)furan-2-yl]-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(Cl)cc2)o1)c1nc(-c2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C26H15ClN2OS/c27-22-9-7-18(8-10-22)25-12-11-23(30-25)14-21(15-28)26-29-24(16-31-26)20-6-5-17-3-1-2-4-19(17)13-20/h1-14,16H/b21-14+ |
| InChIKey | GUYAVEPXONFYFR-KGENOOAVSA-N |
| XLogP | 7.94 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|