C23H14Cl2N2OS — CID 3444689
3-[5-(2,6-dichlorophenyl)furan-2-yl]-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 3444689) has the molecular formula C23H14Cl2N2OS and a molecular weight of 437.35 g/mol. Its IUPAC name is 3-[5-(2,6-dichlorophenyl)furan-2-yl]-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-[5-(2,6-dichlorophenyl)furan-2-yl]-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3444689 |
| Molecular Formula | C23H14Cl2N2OS |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 3-[5-(2,6-dichlorophenyl)furan-2-yl]-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | Cc1ccc(-c2csc(C(C#N)=Cc3ccc(-c4c(Cl)cccc4Cl)o3)n2)cc1 |
| InChI | InChI=1S/C23H14Cl2N2OS/c1-14-5-7-15(8-6-14)20-13-29-23(27-20)16(12-26)11-17-9-10-21(28-17)22-18(24)3-2-4-19(22)25/h2-11,13H,1H3 |
| InChIKey | GJTNTWPACMBBRW-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|