C17H10Cl2N2OS — CID 9212327
(E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 9212327) has the molecular formula C17H10Cl2N2OS and a molecular weight of 361.25 g/mol. Its IUPAC name is (E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9212327 |
| Molecular Formula | C17H10Cl2N2OS |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | (E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1csc(/C(C#N)=C/c2ccc(-c3ccc(Cl)c(Cl)c3)o2)n1 |
| InChI | InChI=1S/C17H10Cl2N2OS/c1-10-9-23-17(21-10)12(8-20)6-13-3-5-16(22-13)11-2-4-14(18)15(19)7-11/h2-7,9H,1H3/b12-6+ |
| InChIKey | QSKUXSQWNMUCIY-WUXMJOGZSA-N |
| XLogP | 6.08 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|