C14H8Cl2N2O2 — CID 51057512
2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]propanedinitrile;hydrate (PubChem CID 51057512) has the molecular formula C14H8Cl2N2O2 and a molecular weight of 307.14 g/mol. Its IUPAC name is 2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]propanedinitrile;hydrate.
| Compound Name | 2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]propanedinitrile;hydrate |
|---|---|
| PubChem CID | 51057512 |
| Molecular Formula | C14H8Cl2N2O2 |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]propanedinitrile;hydrate |
| SMILES | N#CC(C#N)=Cc1ccc(-c2ccc(Cl)c(Cl)c2)o1.O |
| InChI | InChI=1S/C14H6Cl2N2O.H2O/c15-12-3-1-10(6-13(12)16)14-4-2-11(19-14)5-9(7-17)8-18;/h1-6H;1H2 |
| InChIKey | RVUIZYDOPRWWPH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 92.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|