C11H7Cl2NO2 — CID 5343283
(NZ)-N-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]hydroxylamine (PubChem CID 5343283) has the molecular formula C11H7Cl2NO2 and a molecular weight of 256.09 g/mol. Its IUPAC name is (NZ)-N-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 5343283 |
| Molecular Formula | C11H7Cl2NO2 |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | (NZ)-N-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]hydroxylamine |
| SMILES | O/N=C\c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C11H7Cl2NO2/c12-9-3-1-7(5-10(9)13)11-4-2-8(16-11)6-14-15/h1-6,15H/b14-6- |
| InChIKey | DNKJISDWVCAADD-NSIKDUERSA-N |
| XLogP | 4.06 |
| TPSA | 45.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|