C19H10Cl2N2O3 — CID 5437075
2-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]isoindole-1,3-dione (PubChem CID 5437075) has the molecular formula C19H10Cl2N2O3 and a molecular weight of 385.21 g/mol. Its IUPAC name is 2-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]isoindole-1,3-dione.
| Compound Name | 2-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 5437075 |
| Molecular Formula | C19H10Cl2N2O3 |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 2-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1/N=C\c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C19H10Cl2N2O3/c20-15-7-5-11(9-16(15)21)17-8-6-12(26-17)10-22-23-18(24)13-3-1-2-4-14(13)19(23)25/h1-10H/b22-10- |
| InChIKey | HUGCTKKNBJCGMY-YVNNLAQVSA-N |
| XLogP | 4.88 |
| TPSA | 62.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|