C26H16Cl2O3 — CID 3345300
2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-1,3-diphenylpropane-1,3-dione (PubChem CID 3345300) has the molecular formula C26H16Cl2O3 and a molecular weight of 447.32 g/mol. Its IUPAC name is 2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 3345300 |
| Molecular Formula | C26H16Cl2O3 |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-1,3-diphenylpropane-1,3-dione |
| SMILES | O=C(C(=Cc1ccc(-c2ccc(Cl)c(Cl)c2)o1)C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H16Cl2O3/c27-22-13-11-19(15-23(22)28)24-14-12-20(31-24)16-21(25(29)17-7-3-1-4-8-17)26(30)18-9-5-2-6-10-18/h1-16H |
| InChIKey | BBJQEWAEAYYKTJ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|