C20H11Cl2NO3 — CID 3354345
2-chloro-5-[5-[2-(2-chlorophenyl)-2-cyanoethenyl]furan-2-yl]benzoic acid (PubChem CID 3354345) has the molecular formula C20H11Cl2NO3 and a molecular weight of 384.22 g/mol. Its IUPAC name is 2-chloro-5-[5-[2-(2-chlorophenyl)-2-cyanoethenyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-5-[5-[2-(2-chlorophenyl)-2-cyanoethenyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 3354345 |
| Molecular Formula | C20H11Cl2NO3 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | 2-chloro-5-[5-[2-(2-chlorophenyl)-2-cyanoethenyl]furan-2-yl]benzoic acid |
| SMILES | N#CC(=Cc1ccc(-c2ccc(Cl)c(C(=O)O)c2)o1)c1ccccc1Cl |
| InChI | InChI=1S/C20H11Cl2NO3/c21-17-4-2-1-3-15(17)13(11-23)9-14-6-8-19(26-14)12-5-7-18(22)16(10-12)20(24)25/h1-10H,(H,24,25) |
| InChIKey | ZUQBHMVHQOWVOD-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|