C20H11ClINO3 — CID 126377500
2-chloro-5-[5-[(E)-2-cyano-2-(4-iodophenyl)ethenyl]furan-2-yl]benzoic acid (PubChem CID 126377500) has the molecular formula C20H11ClINO3 and a molecular weight of 475.67 g/mol. Its IUPAC name is 2-chloro-5-[5-[(E)-2-cyano-2-(4-iodophenyl)ethenyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-5-[5-[(E)-2-cyano-2-(4-iodophenyl)ethenyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126377500 |
| Molecular Formula | C20H11ClINO3 |
| Molecular Weight | 475.67 g/mol |
| Exact Mass | 474.95 |
| IUPAC Name | 2-chloro-5-[5-[(E)-2-cyano-2-(4-iodophenyl)ethenyl]furan-2-yl]benzoic acid |
| SMILES | N#C/C(=C/c1ccc(-c2ccc(Cl)c(C(=O)O)c2)o1)c1ccc(I)cc1 |
| InChI | InChI=1S/C20H11ClINO3/c21-18-7-3-13(10-17(18)20(24)25)19-8-6-16(26-19)9-14(11-23)12-1-4-15(22)5-2-12/h1-10H,(H,24,25)/b14-9- |
| InChIKey | PMTWEQFISFPAFX-ZROIWOOFSA-N |
| XLogP | 5.97 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.67 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|