C19H10Cl2INO — CID 126374267
(E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-2-(4-iodophenyl)prop-2-enenitrile (PubChem CID 126374267) has the molecular formula C19H10Cl2INO and a molecular weight of 466.11 g/mol. Its IUPAC name is (E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-2-(4-iodophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-2-(4-iodophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126374267 |
| Molecular Formula | C19H10Cl2INO |
| Molecular Weight | 466.11 g/mol |
| Exact Mass | 464.92 |
| IUPAC Name | (E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-2-(4-iodophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1ccc(-c2ccc(Cl)c(Cl)c2)o1)c1ccc(I)cc1 |
| InChI | InChI=1S/C19H10Cl2INO/c20-17-7-3-13(10-18(17)21)19-8-6-16(24-19)9-14(11-23)12-1-4-15(22)5-2-12/h1-10H/b14-9- |
| InChIKey | SFQSYWIZJGUALB-ZROIWOOFSA-N |
| XLogP | 6.92 |
| TPSA | 36.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.11 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|