C21H13Cl2N3O — CID 18231308
(E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile (PubChem CID 18231308) has the molecular formula C21H13Cl2N3O and a molecular weight of 394.26 g/mol. Its IUPAC name is (E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 18231308 |
| Molecular Formula | C21H13Cl2N3O |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | (E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cn1c(/C(C#N)=C/c2ccc(-c3ccc(Cl)c(Cl)c3)o2)nc2ccccc21 |
| InChI | InChI=1S/C21H13Cl2N3O/c1-26-19-5-3-2-4-18(19)25-21(26)14(12-24)10-15-7-9-20(27-15)13-6-8-16(22)17(23)11-13/h2-11H,1H3/b14-10+ |
| InChIKey | NCRJYKULDZEPJK-GXDHUFHOSA-N |
| XLogP | 6.20 |
| TPSA | 54.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|