C21H14ClNO3 — CID 126365380
(E)-2-(1,3-benzodioxol-5-yl)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enenitrile (PubChem CID 126365380) has the molecular formula C21H14ClNO3 and a molecular weight of 363.80 g/mol. Its IUPAC name is (E)-2-(1,3-benzodioxol-5-yl)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzodioxol-5-yl)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 126365380 |
| Molecular Formula | C21H14ClNO3 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | (E)-2-(1,3-benzodioxol-5-yl)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enenitrile |
| SMILES | Cc1ccc(-c2ccc(/C=C(/C#N)c3ccc4c(c3)OCO4)o2)cc1Cl |
| InChI | InChI=1S/C21H14ClNO3/c1-13-2-3-15(9-18(13)22)19-7-5-17(26-19)8-16(11-23)14-4-6-20-21(10-14)25-12-24-20/h2-10H,12H2,1H3/b16-8- |
| InChIKey | DZJYEDFEMUOHOM-PXNMLYILSA-N |
| XLogP | 5.70 |
| TPSA | 55.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|