C21H14N2O6 — CID 126369462
(E)-2-(1,3-benzodioxol-5-yl)-3-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]prop-2-enenitrile (PubChem CID 126369462) has the molecular formula C21H14N2O6 and a molecular weight of 390.35 g/mol. Its IUPAC name is (E)-2-(1,3-benzodioxol-5-yl)-3-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzodioxol-5-yl)-3-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 126369462 |
| Molecular Formula | C21H14N2O6 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (E)-2-(1,3-benzodioxol-5-yl)-3-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]prop-2-enenitrile |
| SMILES | COc1ccc(-c2ccc(/C=C(/C#N)c3ccc4c(c3)OCO4)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H14N2O6/c1-26-15-3-5-17(18(10-15)23(24)25)19-7-4-16(29-19)8-14(11-22)13-2-6-20-21(9-13)28-12-27-20/h2-10H,12H2,1H3/b14-8- |
| InChIKey | OUCAJTVTIDCKFD-ZSOIEALJSA-N |
| XLogP | 4.66 |
| TPSA | 107.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|