C18H15NO4 — CID 126370485
(E)-2-(1,3-benzodioxol-5-yl)-3-(2,5-dimethoxyphenyl)prop-2-enenitrile (PubChem CID 126370485) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is (E)-2-(1,3-benzodioxol-5-yl)-3-(2,5-dimethoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzodioxol-5-yl)-3-(2,5-dimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126370485 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (E)-2-(1,3-benzodioxol-5-yl)-3-(2,5-dimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(OC)c(/C=C(/C#N)c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C18H15NO4/c1-20-15-4-6-16(21-2)13(8-15)7-14(10-19)12-3-5-17-18(9-12)23-11-22-17/h3-9H,11H2,1-2H3/b14-7- |
| InChIKey | RYVOSEITZNXXLI-AUWJEWJLSA-N |
| XLogP | 3.50 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|