C24H27NO5 — CID 123199788
2-(1,3-benzodioxol-5-yl)-3-(4-hexoxy-3,5-dimethoxyphenyl)prop-2-enenitrile (PubChem CID 123199788) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-3-(4-hexoxy-3,5-dimethoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-3-(4-hexoxy-3,5-dimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 123199788 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-3-(4-hexoxy-3,5-dimethoxyphenyl)prop-2-enenitrile |
| SMILES | CCCCCCOc1c(OC)cc(C=C(C#N)c2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C24H27NO5/c1-4-5-6-7-10-28-24-22(26-2)12-17(13-23(24)27-3)11-19(15-25)18-8-9-20-21(14-18)30-16-29-20/h8-9,11-14H,4-7,10,16H2,1-3H3 |
| InChIKey | YXWPOMFYZBMPFB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 69.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|