C28H31NO7 — CID 89415547
6-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]-2,6-dimethoxyphenoxy]hexyl 2-methylprop-2-enoate (PubChem CID 89415547) has the molecular formula C28H31NO7 and a molecular weight of 493.56 g/mol. Its IUPAC name is 6-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]-2,6-dimethoxyphenoxy]hexyl 2-methylprop-2-enoate.
| Compound Name | 6-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]-2,6-dimethoxyphenoxy]hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89415547 |
| Molecular Formula | C28H31NO7 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 6-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]-2,6-dimethoxyphenoxy]hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1c(OC)cc(/C=C(\C#N)c2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C28H31NO7/c1-19(2)28(30)34-12-8-6-5-7-11-33-27-25(31-3)14-20(15-26(27)32-4)13-22(17-29)21-9-10-23-24(16-21)36-18-35-23/h9-10,13-16H,1,5-8,11-12,18H2,2-4H3/b22-13+ |
| InChIKey | JZUVSVGDSZTXGL-LPYMAVHISA-N |
| XLogP | 5.56 |
| TPSA | 96.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|