C17H13NO4 — CID 147548701
(Z)-2-(1,3-benzodioxol-5-yl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enenitrile (PubChem CID 147548701) has the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. Its IUPAC name is (Z)-2-(1,3-benzodioxol-5-yl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzodioxol-5-yl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 147548701 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (Z)-2-(1,3-benzodioxol-5-yl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(\C#N)c2ccc3c(c2)OCO3)ccc1O |
| InChI | InChI=1S/C17H13NO4/c1-20-16-7-11(2-4-14(16)19)6-13(9-18)12-3-5-15-17(8-12)22-10-21-15/h2-8,19H,10H2,1H3/b13-6+ |
| InChIKey | FQIQLSALYIBGQC-AWNIVKPZSA-N |
| XLogP | 3.19 |
| TPSA | 71.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|